C10H10N2O3 — CID 71303885
6,7-dimethoxy-4aH-quinazolin-4-one (PubChem CID 71303885) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 6,7-dimethoxy-4aH-quinazolin-4-one.
| Compound Name | 6,7-dimethoxy-4aH-quinazolin-4-one |
|---|---|
| PubChem CID | 71303885 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 6,7-dimethoxy-4aH-quinazolin-4-one |
| SMILES | COC1=CC2=NC=NC(=O)C2C=C1OC |
| InChI | InChI=1S/C10H10N2O3/c1-14-8-3-6-7(4-9(8)15-2)11-5-12-10(6)13/h3-6H,1-2H3 |
| InChIKey | ZYFJPZVUQRQVRT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |