C12H14N2O3 — CID 73025681
6,7-diethoxy-4aH-quinazolin-4-one (PubChem CID 73025681) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 6,7-diethoxy-4aH-quinazolin-4-one.
| Compound Name | 6,7-diethoxy-4aH-quinazolin-4-one |
|---|---|
| PubChem CID | 73025681 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 6,7-diethoxy-4aH-quinazolin-4-one |
| SMILES | CCOC1=CC2=NC=NC(=O)C2C=C1OCC |
| InChI | InChI=1S/C12H14N2O3/c1-3-16-10-5-8-9(6-11(10)17-4-2)13-7-14-12(8)15/h5-8H,3-4H2,1-2H3 |
| InChIKey | BQVWAOIXEFHXRX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |