About 2-methylquinazoline-4,6-dione
2-methylquinazoline-4,6-dione (PubChem CID 71303969) has the molecular formula C9H6N2O2
and a molecular weight of 174.16 g/mol. Its IUPAC name is 2-methylquinazoline-4,6-dione.
Molecular Properties
| Compound Name | 2-methylquinazoline-4,6-dione |
| PubChem CID | 71303969 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 2-methylquinazoline-4,6-dione |
| SMILES | CC1=NC(=O)C2=CC(=O)C=CC2=N1 |
| InChI | InChI=1S/C9H6N2O2/c1-5-10-8-3-2-6(12)4-7(8)9(13)11-5/h2-4H,1H3 |
| InChIKey | SDEPGKIEFRPTQK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylquinazoline-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylquinazoline-4,6-dione?
The IUPAC name of 2-methylquinazoline-4,6-dione (CID 71303969) is 2-methylquinazoline-4,6-dione.
What is the SMILES notation for 2-methylquinazoline-4,6-dione?
The canonical SMILES for 2-methylquinazoline-4,6-dione is CC1=NC(=O)C2=CC(=O)C=CC2=N1.
What is the InChIKey of 2-methylquinazoline-4,6-dione?
The InChIKey is SDEPGKIEFRPTQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2/c1-5-10-8-3-2-6(12)4-7(8)9(13)11-5/h2-4H,1H3.
What are the key properties of 2-methylquinazoline-4,6-dione?
2-methylquinazoline-4,6-dione has a molecular weight of 174.16 g/mol, XLogP of 0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylquinazoline-4,6-dione is sourced from PubChem (CID 71303969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).