About 1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone
1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone (PubChem CID 71304792) has the molecular formula C23H26N2O3
and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone.
Molecular Properties
| Compound Name | 1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone |
| PubChem CID | 71304792 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone |
| SMILES | O=C([C@H]1CCCCN1C(=O)COc1ccccc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H26N2O3/c26-22(17-28-20-10-2-1-3-11-20)25-14-7-6-12-21(25)23(27)24-15-13-18-8-4-5-9-19(18)16-24/h1-5,8-11,21H,6-7,12-17H2/t21-/m1/s1 |
| InChIKey | CJQMUNJPWNNVDR-OAQYLSRUSA-N |
| XLogP | 3.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone?
The IUPAC name of 1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone (CID 71304792) is 1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone.
What is the SMILES notation for 1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone?
The canonical SMILES for 1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone is O=C([C@H]1CCCCN1C(=O)COc1ccccc1)N1CCc2ccccc2C1.
What is the InChIKey of 1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone?
The InChIKey is CJQMUNJPWNNVDR-OAQYLSRUSA-N. The full InChI is InChI=1S/C23H26N2O3/c26-22(17-28-20-10-2-1-3-11-20)25-14-7-6-12-21(25)23(27)24-15-13-18-8-4-5-9-19(18)16-24/h1-5,8-11,21H,6-7,12-17H2/t21-/m1/s1.
What are the key properties of 1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone?
1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone has a molecular weight of 378.47 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]-2-phenoxyethanone is sourced from PubChem (CID 71304792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).