C18H20N4 — CID 71307856
3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 71307856) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 71307856 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Cc1cc(-c2nnc3n2CCCC3)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C18H20N4/c1-13-12-16(14(2)22(13)15-8-4-3-5-9-15)18-20-19-17-10-6-7-11-21(17)18/h3-5,8-9,12H,6-7,10-11H2,1-2H3 |
| InChIKey | PQWSFDQFDHGRBV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|