C13H18N2 — CID 71313195
4-[2-[prop-2-ynyl(trideuteriomethyl)amino]propyl]aniline (PubChem CID 71313195) has the molecular formula C13H18N2 and a molecular weight of 205.32 g/mol. Its IUPAC name is 4-[2-[prop-2-ynyl(trideuteriomethyl)amino]propyl]aniline.
| Compound Name | 4-[2-[prop-2-ynyl(trideuteriomethyl)amino]propyl]aniline |
|---|---|
| PubChem CID | 71313195 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | 4-[2-[prop-2-ynyl(trideuteriomethyl)amino]propyl]aniline |
| SMILES | [2H]C([2H])([2H])N(CC#C)C(C)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C13H18N2/c1-4-9-15(3)11(2)10-12-5-7-13(14)8-6-12/h1,5-8,11H,9-10,14H2,2-3H3/i3D3 |
| InChIKey | XXFSWRABMGXENS-HPRDVNIFSA-N |
| XLogP | 1.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|