C18H19NO3S — CID 713147
2-methylsulfanyl-N-(6-propyl-1,3-benzodioxol-5-yl)benzamide (PubChem CID 713147) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-methylsulfanyl-N-(6-propyl-1,3-benzodioxol-5-yl)benzamide.
| Compound Name | 2-methylsulfanyl-N-(6-propyl-1,3-benzodioxol-5-yl)benzamide |
|---|---|
| PubChem CID | 713147 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-methylsulfanyl-N-(6-propyl-1,3-benzodioxol-5-yl)benzamide |
| SMILES | CCCc1cc2c(cc1NC(=O)c1ccccc1SC)OCO2 |
| InChI | InChI=1S/C18H19NO3S/c1-3-6-12-9-15-16(22-11-21-15)10-14(12)19-18(20)13-7-4-5-8-17(13)23-2/h4-5,7-10H,3,6,11H2,1-2H3,(H,19,20) |
| InChIKey | BOSDIIWNSAEMAJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |