C22H21NO4 — CID 1263849
1-methoxy-N-(6-propyl-1,3-benzodioxol-5-yl)naphthalene-2-carboxamide (PubChem CID 1263849) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-methoxy-N-(6-propyl-1,3-benzodioxol-5-yl)naphthalene-2-carboxamide.
| Compound Name | 1-methoxy-N-(6-propyl-1,3-benzodioxol-5-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 1263849 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-methoxy-N-(6-propyl-1,3-benzodioxol-5-yl)naphthalene-2-carboxamide |
| SMILES | CCCc1cc2c(cc1NC(=O)c1ccc3ccccc3c1OC)OCO2 |
| InChI | InChI=1S/C22H21NO4/c1-3-6-15-11-19-20(27-13-26-19)12-18(15)23-22(24)17-10-9-14-7-4-5-8-16(14)21(17)25-2/h4-5,7-12H,3,6,13H2,1-2H3,(H,23,24) |
| InChIKey | ZJSNBFMUQOQGKN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |