C9H11FNS+ — CID 7131598
[(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]azanium (PubChem CID 7131598) has the molecular formula C9H11FNS+ and a molecular weight of 184.26 g/mol. Its IUPAC name is [(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]azanium.
| Compound Name | [(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]azanium |
|---|---|
| PubChem CID | 7131598 |
| Molecular Formula | C9H11FNS+ |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | [(4S)-8-fluoro-3,4-dihydro-2H-thiochromen-4-yl]azanium |
| SMILES | [NH3+][C@H]1CCSc2c(F)cccc21 |
| InChI | InChI=1S/C9H10FNS/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-3,8H,4-5,11H2/p+1/t8-/m0/s1 |
| InChIKey | RSQICZUGVXJDHV-QMMMGPOBSA-O |
| XLogP | 1.60 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |