C17H18FNS2 — CID 60976209
8-fluoro-N-(2-phenylsulfanylethyl)-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 60976209) has the molecular formula C17H18FNS2 and a molecular weight of 319.47 g/mol. Its IUPAC name is 8-fluoro-N-(2-phenylsulfanylethyl)-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | 8-fluoro-N-(2-phenylsulfanylethyl)-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 60976209 |
| Molecular Formula | C17H18FNS2 |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 8-fluoro-N-(2-phenylsulfanylethyl)-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | Fc1cccc2c1SCCC2NCCSc1ccccc1 |
| InChI | InChI=1S/C17H18FNS2/c18-15-8-4-7-14-16(9-11-21-17(14)15)19-10-12-20-13-5-2-1-3-6-13/h1-8,16,19H,9-12H2 |
| InChIKey | IJHVUGQXHZOJOH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|