About 8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine
8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 63242211) has the molecular formula C14H15FN2S2
and a molecular weight of 294.42 g/mol. Its IUPAC name is 8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine.
Molecular Properties
| Compound Name | 8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine |
| PubChem CID | 63242211 |
| Molecular Formula | C14H15FN2S2 |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | Fc1cccc2c1SCCC2NCCc1nccs1 |
| InChI | InChI=1S/C14H15FN2S2/c15-11-3-1-2-10-12(5-8-19-14(10)11)16-6-4-13-17-7-9-18-13/h1-3,7,9,12,16H,4-6,8H2 |
| InChIKey | SZDQEAJCLMBGLL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine?
The IUPAC name of 8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine (CID 63242211) is 8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine.
What is the SMILES notation for 8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine?
The canonical SMILES for 8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine is Fc1cccc2c1SCCC2NCCc1nccs1.
What is the InChIKey of 8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine?
The InChIKey is SZDQEAJCLMBGLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15FN2S2/c15-11-3-1-2-10-12(5-8-19-14(10)11)16-6-4-13-17-7-9-18-13/h1-3,7,9,12,16H,4-6,8H2.
What are the key properties of 8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine?
8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine has a molecular weight of 294.42 g/mol, XLogP of 3.65, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine is sourced from PubChem (CID 63242211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).