C21H31N5O4 — CID 71316231
6,10-dihydroxy-8-[1,1,2,2,3,3,4,4-octadeuterio-4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 71316231) has the molecular formula C21H31N5O4 and a molecular weight of 425.56 g/mol. Its IUPAC name is 6,10-dihydroxy-8-[1,1,2,2,3,3,4,4-octadeuterio-4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 6,10-dihydroxy-8-[1,1,2,2,3,3,4,4-octadeuterio-4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 71316231 |
| Molecular Formula | C21H31N5O4 |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 6,10-dihydroxy-8-[1,1,2,2,3,3,4,4-octadeuterio-4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | [2H]C([2H])(N1CCN(c2ncccn2)CC1)C([2H])([2H])C([2H])([2H])C([2H])([2H])N1C(=O)C(O)C2(CCCC2)C(O)C1=O |
| InChI | InChI=1S/C21H31N5O4/c27-16-18(29)26(19(30)17(28)21(16)6-1-2-7-21)11-4-3-10-24-12-14-25(15-13-24)20-22-8-5-9-23-20/h5,8-9,16-17,27-28H,1-4,6-7,10-15H2/i3D2,4D2,10D2,11D2 |
| InChIKey | GZDZGTXOYYJHTI-QGZHXTQCSA-N |
| XLogP | 0.03 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|