C21H23NO5 — CID 71317207
[(2S,4R,4aR,7S,7aR,12bS)-9-acetyloxy-1,1,2-trideuterio-3-(trideuteriomethyl)-2,4,4a,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate (PubChem CID 71317207) has the molecular formula C21H23NO5 and a molecular weight of 375.45 g/mol. Its IUPAC name is [(2S,4R,4aR,7S,7aR,12bS)-9-acetyloxy-1,1,2-trideuterio-3-(trideuteriomethyl)-2,4,4a,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate.
| Compound Name | [(2S,4R,4aR,7S,7aR,12bS)-9-acetyloxy-1,1,2-trideuterio-3-(trideuteriomethyl)-2,4,4a,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
|---|---|
| PubChem CID | 71317207 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | [(2S,4R,4aR,7S,7aR,12bS)-9-acetyloxy-1,1,2-trideuterio-3-(trideuteriomethyl)-2,4,4a,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
| SMILES | [2H][C@@H]1N(C([2H])([2H])[2H])[C@@H]2Cc3ccc(OC(C)=O)c4c3[C@@]3([C@H]2C=C[C@H](OC(C)=O)[C@@H]3O4)C1([2H])[2H] |
| InChI | InChI=1S/C21H23NO5/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20/h4-7,14-15,17,20H,8-10H2,1-3H3/t14-,15+,17-,20-,21-/m0/s1/i3D3,8D2,9D/t9-,14-,15+,17-,20-,21- |
| InChIKey | GVGLGOZIDCSQPN-MLNNSVEOSA-N |
| XLogP | 1.99 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|