C17H12FN3OS — CID 713174
(2S)-2-(4-fluorophenyl)-6-oxo-3-phenyl-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile (PubChem CID 713174) has the molecular formula C17H12FN3OS and a molecular weight of 325.37 g/mol. Its IUPAC name is (2S)-2-(4-fluorophenyl)-6-oxo-3-phenyl-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile.
| Compound Name | (2S)-2-(4-fluorophenyl)-6-oxo-3-phenyl-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 713174 |
| Molecular Formula | C17H12FN3OS |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (2S)-2-(4-fluorophenyl)-6-oxo-3-phenyl-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
| SMILES | N#CC1=C(S)N(c2ccccc2)[C@@H](c2ccc(F)cc2)NC1=O |
| InChI | InChI=1S/C17H12FN3OS/c18-12-8-6-11(7-9-12)15-20-16(22)14(10-19)17(23)21(15)13-4-2-1-3-5-13/h1-9,15,23H,(H,20,22)/t15-/m0/s1 |
| InChIKey | MTIXDDWAAOIRJP-HNNXBMFYSA-N |
| XLogP | 3.13 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|