C18H37NO4Si — CID 71319242
2-[11-[hydroxy(dimethyl)silyl]undecanoylamino]-3-methylbutanoic acid (PubChem CID 71319242) has the molecular formula C18H37NO4Si and a molecular weight of 359.58 g/mol. Its IUPAC name is 2-[11-[hydroxy(dimethyl)silyl]undecanoylamino]-3-methylbutanoic acid.
| Compound Name | 2-[11-[hydroxy(dimethyl)silyl]undecanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 71319242 |
| Molecular Formula | C18H37NO4Si |
| Molecular Weight | 359.58 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 2-[11-[hydroxy(dimethyl)silyl]undecanoylamino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)CCCCCCCCCC[Si](C)(C)O)C(=O)O |
| InChI | InChI=1S/C18H37NO4Si/c1-15(2)17(18(21)22)19-16(20)13-11-9-7-5-6-8-10-12-14-24(3,4)23/h15,17,23H,5-14H2,1-4H3,(H,19,20)(H,21,22) |
| InChIKey | JKSMWFUXMVYFKU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|