About [(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate
[(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate (PubChem CID 71320107) has the molecular formula C15H17N3O3S
and a molecular weight of 319.39 g/mol. Its IUPAC name is [(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate.
Molecular Properties
| Compound Name | [(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate |
| PubChem CID | 71320107 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | [(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate |
| SMILES | CCCSC(=O)ON=C(N)COc1cccc2cccnc12 |
| InChI | InChI=1S/C15H17N3O3S/c1-2-9-22-15(19)21-18-13(16)10-20-12-7-3-5-11-6-4-8-17-14(11)12/h3-8H,2,9-10H2,1H3,(H2,16,18) |
| InChIKey | GCCOJPCJNUIGTB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate?
The IUPAC name of [(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate (CID 71320107) is [(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate.
What is the SMILES notation for [(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate?
The canonical SMILES for [(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate is CCCSC(=O)ON=C(N)COc1cccc2cccnc12.
What is the InChIKey of [(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate?
The InChIKey is GCCOJPCJNUIGTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3S/c1-2-9-22-15(19)21-18-13(16)10-20-12-7-3-5-11-6-4-8-17-14(11)12/h3-8H,2,9-10H2,1H3,(H2,16,18).
What are the key properties of [(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate?
[(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate has a molecular weight of 319.39 g/mol, XLogP of 3.17, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1-amino-2-quinolin-8-yloxyethylidene)amino] propylsulfanylformate is sourced from PubChem (CID 71320107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).