C17H21NO5 — CID 71320764
4-aminobenzoic acid;2-(2-phenoxyethoxy)ethanol (PubChem CID 71320764) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-aminobenzoic acid;2-(2-phenoxyethoxy)ethanol.
| Compound Name | 4-aminobenzoic acid;2-(2-phenoxyethoxy)ethanol |
|---|---|
| PubChem CID | 71320764 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 4-aminobenzoic acid;2-(2-phenoxyethoxy)ethanol |
| SMILES | Nc1ccc(C(=O)O)cc1.OCCOCCOc1ccccc1 |
| InChI | InChI=1S/C10H14O3.C7H7NO2/c11-6-7-12-8-9-13-10-4-2-1-3-5-10;8-6-3-1-5(2-4-6)7(9)10/h1-5,11H,6-9H2;1-4H,8H2,(H,9,10) |
| InChIKey | NRRJWXHZEXUZBK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|