C10H6FNO2 — CID 71323051
4-[(2-fluorophenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 71323051) has the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 4-[(2-fluorophenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 71323051 |
| Molecular Formula | C10H6FNO2 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 4-[(2-fluorophenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC=NC1=Cc1ccccc1F |
| InChI | InChI=1S/C10H6FNO2/c11-8-4-2-1-3-7(8)5-9-10(13)14-6-12-9/h1-6H |
| InChIKey | VVOQAOLTJQNMPG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|