About 2,6-dihydroxy-2,6-dimethyloct-7-en-3-one
2,6-dihydroxy-2,6-dimethyloct-7-en-3-one (PubChem CID 71324057) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2,6-dihydroxy-2,6-dimethyloct-7-en-3-one.
Molecular Properties
| Compound Name | 2,6-dihydroxy-2,6-dimethyloct-7-en-3-one |
| PubChem CID | 71324057 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2,6-dihydroxy-2,6-dimethyloct-7-en-3-one |
| SMILES | C=CC(C)(O)CCC(=O)C(C)(C)O |
| InChI | InChI=1S/C10H18O3/c1-5-10(4,13)7-6-8(11)9(2,3)12/h5,12-13H,1,6-7H2,2-4H3 |
| InChIKey | VKXFRUXSIVKGDM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dihydroxy-2,6-dimethyloct-7-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dihydroxy-2,6-dimethyloct-7-en-3-one?
The IUPAC name of 2,6-dihydroxy-2,6-dimethyloct-7-en-3-one (CID 71324057) is 2,6-dihydroxy-2,6-dimethyloct-7-en-3-one.
What is the SMILES notation for 2,6-dihydroxy-2,6-dimethyloct-7-en-3-one?
The canonical SMILES for 2,6-dihydroxy-2,6-dimethyloct-7-en-3-one is C=CC(C)(O)CCC(=O)C(C)(C)O.
What is the InChIKey of 2,6-dihydroxy-2,6-dimethyloct-7-en-3-one?
The InChIKey is VKXFRUXSIVKGDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-5-10(4,13)7-6-8(11)9(2,3)12/h5,12-13H,1,6-7H2,2-4H3.
What are the key properties of 2,6-dihydroxy-2,6-dimethyloct-7-en-3-one?
2,6-dihydroxy-2,6-dimethyloct-7-en-3-one has a molecular weight of 186.25 g/mol, XLogP of 1.04, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dihydroxy-2,6-dimethyloct-7-en-3-one is sourced from PubChem (CID 71324057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).