C17H30N2O2 — CID 71328789
acetic acid;N-(2-pyridin-2-ylethyl)octan-1-amine (PubChem CID 71328789) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is acetic acid;N-(2-pyridin-2-ylethyl)octan-1-amine.
| Compound Name | acetic acid;N-(2-pyridin-2-ylethyl)octan-1-amine |
|---|---|
| PubChem CID | 71328789 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | acetic acid;N-(2-pyridin-2-ylethyl)octan-1-amine |
| SMILES | CC(=O)O.CCCCCCCCNCCc1ccccn1 |
| InChI | InChI=1S/C15H26N2.C2H4O2/c1-2-3-4-5-6-8-12-16-14-11-15-10-7-9-13-17-15;1-2(3)4/h7,9-10,13,16H,2-6,8,11-12,14H2,1H3;1H3,(H,3,4) |
| InChIKey | HLABPQWVIFQGOX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|