About 2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium
2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium (PubChem CID 71329196) has the molecular formula C16H27S+
and a molecular weight of 251.46 g/mol. Its IUPAC name is 2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium.
Molecular Properties
| Compound Name | 2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium |
| PubChem CID | 71329196 |
| Molecular Formula | C16H27S+ |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | 2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium |
| SMILES | CC1=CC(C(C)(C)C)=[S+]C(C(C)(C)C)=CC1C |
| InChI | InChI=1S/C16H27S/c1-11-9-13(15(3,4)5)17-14(10-12(11)2)16(6,7)8/h9-11H,1-8H3/q+1 |
| InChIKey | MJGYWTGZCQXMJA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium?
The IUPAC name of 2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium (CID 71329196) is 2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium.
What is the SMILES notation for 2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium?
The canonical SMILES for 2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium is CC1=CC(C(C)(C)C)=[S+]C(C(C)(C)C)=CC1C.
What is the InChIKey of 2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium?
The InChIKey is MJGYWTGZCQXMJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27S/c1-11-9-13(15(3,4)5)17-14(10-12(11)2)16(6,7)8/h9-11H,1-8H3/q+1.
What are the key properties of 2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium?
2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium has a molecular weight of 251.46 g/mol, XLogP of 4.81, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-ditert-butyl-4,5-dimethyl-4H-thiepin-1-ium is sourced from PubChem (CID 71329196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).