About acetic acid;ethenyl(hydroxy)silane
acetic acid;ethenyl(hydroxy)silane (PubChem CID 71332548) has the molecular formula C4H10O3Si
and a molecular weight of 134.21 g/mol. Its IUPAC name is acetic acid;ethenyl(hydroxy)silane.
Molecular Properties
| Compound Name | acetic acid;ethenyl(hydroxy)silane |
| PubChem CID | 71332548 |
| Molecular Formula | C4H10O3Si |
| Molecular Weight | 134.21 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | acetic acid;ethenyl(hydroxy)silane |
| SMILES | C=C[SiH2]O.CC(=O)O |
| InChI | InChI=1S/C2H4O2.C2H6OSi/c1-2(3)4;1-2-4-3/h1H3,(H,3,4);2-3H,1,4H2 |
| InChIKey | BQKPECFMPXPSDL-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.21 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;ethenyl(hydroxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;ethenyl(hydroxy)silane?
The IUPAC name of acetic acid;ethenyl(hydroxy)silane (CID 71332548) is acetic acid;ethenyl(hydroxy)silane.
What is the SMILES notation for acetic acid;ethenyl(hydroxy)silane?
The canonical SMILES for acetic acid;ethenyl(hydroxy)silane is C=C[SiH2]O.CC(=O)O.
What is the InChIKey of acetic acid;ethenyl(hydroxy)silane?
The InChIKey is BQKPECFMPXPSDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.C2H6OSi/c1-2(3)4;1-2-4-3/h1H3,(H,3,4);2-3H,1,4H2.
What are the key properties of acetic acid;ethenyl(hydroxy)silane?
acetic acid;ethenyl(hydroxy)silane has a molecular weight of 134.21 g/mol, XLogP of -0.70, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;ethenyl(hydroxy)silane is sourced from PubChem (CID 71332548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).