C35H51O2S2+ — CID 71333140
3,5-bis(3-decoxyphenyl)dithiol-1-ium (PubChem CID 71333140) has the molecular formula C35H51O2S2+ and a molecular weight of 567.93 g/mol. Its IUPAC name is 3,5-bis(3-decoxyphenyl)dithiol-1-ium.
| Compound Name | 3,5-bis(3-decoxyphenyl)dithiol-1-ium |
|---|---|
| PubChem CID | 71333140 |
| Molecular Formula | C35H51O2S2+ |
| Molecular Weight | 567.93 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | 3,5-bis(3-decoxyphenyl)dithiol-1-ium |
| SMILES | CCCCCCCCCCOc1cccc(-c2cc(-c3cccc(OCCCCCCCCCC)c3)[s+]s2)c1 |
| InChI | InChI=1S/C35H51O2S2/c1-3-5-7-9-11-13-15-17-25-36-32-23-19-21-30(27-32)34-29-35(39-38-34)31-22-20-24-33(28-31)37-26-18-16-14-12-10-8-6-4-2/h19-24,27-29H,3-18,25-26H2,1-2H3/q+1 |
| InChIKey | MTENPQDBPWJKDZ-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.93 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|