C27H42O6 — CID 71337782
(6,17-diacetyloxy-17-ethyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) acetate (PubChem CID 71337782) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is (6,17-diacetyloxy-17-ethyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) acetate.
| Compound Name | (6,17-diacetyloxy-17-ethyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) acetate |
|---|---|
| PubChem CID | 71337782 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (6,17-diacetyloxy-17-ethyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) acetate |
| SMILES | CCC1(OC(C)=O)CCC2C3CC(OC(C)=O)C4CC(OC(C)=O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C27H42O6/c1-7-27(33-18(4)30)13-10-22-20-15-24(32-17(3)29)23-14-19(31-16(2)28)8-11-25(23,5)21(20)9-12-26(22,27)6/h19-24H,7-15H2,1-6H3 |
| InChIKey | HPZKYKCADPJTJH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|