C33H62O4Si2 — CID 123729814
[(8R,9R,10R,13S,14S)-3,17-bis(2,3-dimethylbutan-2-ylsilyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] acetate (PubChem CID 123729814) has the molecular formula C33H62O4Si2 and a molecular weight of 579.03 g/mol. Its IUPAC name is [(8R,9R,10R,13S,14S)-3,17-bis(2,3-dimethylbutan-2-ylsilyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] acetate.
| Compound Name | [(8R,9R,10R,13S,14S)-3,17-bis(2,3-dimethylbutan-2-ylsilyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] acetate |
|---|---|
| PubChem CID | 123729814 |
| Molecular Formula | C33H62O4Si2 |
| Molecular Weight | 579.03 g/mol |
| Exact Mass | 578.42 |
| IUPAC Name | [(8R,9R,10R,13S,14S)-3,17-bis(2,3-dimethylbutan-2-ylsilyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] acetate |
| SMILES | CC(=O)OC1C[C@@H]2[C@@H](CC[C@]3(C)C(O[SiH2]C(C)(C)C(C)C)CC[C@@H]23)[C@@]2(C)CCC(O[SiH2]C(C)(C)C(C)C)CC12 |
| InChI | InChI=1S/C33H62O4Si2/c1-20(2)30(6,7)38-36-23-14-16-32(10)26-15-17-33(11)25(12-13-29(33)37-39-31(8,9)21(3)4)24(26)19-28(27(32)18-23)35-22(5)34/h20-21,23-29H,12-19,38-39H2,1-11H3/t23?,24-,25-,26+,27?,28?,29?,32+,33-/m0/s1 |
| InChIKey | DKGZQJQTOZZJDS-LUNUYVLLSA-N |
| XLogP | 7.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.03 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|