C18H32IN — CID 71337832
4-(9,9-dimethyldecyl)-1-methylpyridin-1-ium iodide (PubChem CID 71337832) has the molecular formula C18H32IN and a molecular weight of 389.37 g/mol. Its IUPAC name is 4-(9,9-dimethyldecyl)-1-methylpyridin-1-ium iodide.
| Compound Name | 4-(9,9-dimethyldecyl)-1-methylpyridin-1-ium iodide |
|---|---|
| PubChem CID | 71337832 |
| Molecular Formula | C18H32IN |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 4-(9,9-dimethyldecyl)-1-methylpyridin-1-ium iodide |
| SMILES | C[n+]1ccc(CCCCCCCCC(C)(C)C)cc1.[I-] |
| InChI | InChI=1S/C18H32N.HI/c1-18(2,3)14-10-8-6-5-7-9-11-17-12-15-19(4)16-13-17;/h12-13,15-16H,5-11,14H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FEDRGQFVRCWNMC-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|