C12H18NO2+ — CID 153418584
2,2-dimethyl-4-(1-methylpyridin-1-ium-4-yl)butanoic acid (PubChem CID 153418584) has the molecular formula C12H18NO2+ and a molecular weight of 208.28 g/mol. Its IUPAC name is 2,2-dimethyl-4-(1-methylpyridin-1-ium-4-yl)butanoic acid.
| Compound Name | 2,2-dimethyl-4-(1-methylpyridin-1-ium-4-yl)butanoic acid |
|---|---|
| PubChem CID | 153418584 |
| Molecular Formula | C12H18NO2+ |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2,2-dimethyl-4-(1-methylpyridin-1-ium-4-yl)butanoic acid |
| SMILES | C[n+]1ccc(CCC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C12H17NO2/c1-12(2,11(14)15)7-4-10-5-8-13(3)9-6-10/h5-6,8-9H,4,7H2,1-3H3/p+1 |
| InChIKey | TUJUUEYLMSRYPW-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|