About (5-nitrofuran-2-yl) thiocyanate
(5-nitrofuran-2-yl) thiocyanate (PubChem CID 71338017) has the molecular formula C5H2N2O3S
and a molecular weight of 170.15 g/mol. Its IUPAC name is (5-nitrofuran-2-yl) thiocyanate.
Molecular Properties
| Compound Name | (5-nitrofuran-2-yl) thiocyanate |
| PubChem CID | 71338017 |
| Molecular Formula | C5H2N2O3S |
| Molecular Weight | 170.15 g/mol |
| Exact Mass | 169.98 |
| IUPAC Name | (5-nitrofuran-2-yl) thiocyanate |
| SMILES | N#CSc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C5H2N2O3S/c6-3-11-5-2-1-4(10-5)7(8)9/h1-2H |
| InChIKey | FAVLTZDNJZMDOG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.15 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-nitrofuran-2-yl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-nitrofuran-2-yl) thiocyanate?
The IUPAC name of (5-nitrofuran-2-yl) thiocyanate (CID 71338017) is (5-nitrofuran-2-yl) thiocyanate.
What is the SMILES notation for (5-nitrofuran-2-yl) thiocyanate?
The canonical SMILES for (5-nitrofuran-2-yl) thiocyanate is N#CSc1ccc([N+](=O)[O-])o1.
What is the InChIKey of (5-nitrofuran-2-yl) thiocyanate?
The InChIKey is FAVLTZDNJZMDOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2N2O3S/c6-3-11-5-2-1-4(10-5)7(8)9/h1-2H.
What are the key properties of (5-nitrofuran-2-yl) thiocyanate?
(5-nitrofuran-2-yl) thiocyanate has a molecular weight of 170.15 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-nitrofuran-2-yl) thiocyanate is sourced from PubChem (CID 71338017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).