About N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide
N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide (PubChem CID 71339693) has the molecular formula C25H23N2O3P
and a molecular weight of 430.44 g/mol. Its IUPAC name is N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide |
| PubChem CID | 71339693 |
| Molecular Formula | C25H23N2O3P |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CC(=P(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)NC1=O |
| InChI | InChI=1S/C25H23N2O3P/c1-18(28)26-22-17-23(25(30)27-24(22)29)31(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22H,17H2,1H3,(H,26,28)(H,27,29,30) |
| InChIKey | WUOJCTVTHMPBKY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide?
The IUPAC name of N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide (CID 71339693) is N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide.
What is the SMILES notation for N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide?
The canonical SMILES for N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide is CC(=O)NC1CC(=P(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)NC1=O.
What is the InChIKey of N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide?
The InChIKey is WUOJCTVTHMPBKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N2O3P/c1-18(28)26-22-17-23(25(30)27-24(22)29)31(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22H,17H2,1H3,(H,26,28)(H,27,29,30).
What are the key properties of N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide?
N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide has a molecular weight of 430.44 g/mol, XLogP of 1.70, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,6-dioxo-5-(triphenyl-λ5-phosphanylidene)piperidin-3-yl]acetamide is sourced from PubChem (CID 71339693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).