C27H33N3O2P+ — CID 90424568
[4-[2-[[2-(methylamino)acetyl]amino]ethylamino]-4-oxobutyl]-triphenylphosphanium (PubChem CID 90424568) has the molecular formula C27H33N3O2P+ and a molecular weight of 462.55 g/mol. Its IUPAC name is [4-[2-[[2-(methylamino)acetyl]amino]ethylamino]-4-oxobutyl]-triphenylphosphanium.
| Compound Name | [4-[2-[[2-(methylamino)acetyl]amino]ethylamino]-4-oxobutyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 90424568 |
| Molecular Formula | C27H33N3O2P+ |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | [4-[2-[[2-(methylamino)acetyl]amino]ethylamino]-4-oxobutyl]-triphenylphosphanium |
| SMILES | CNCC(=O)NCCNC(=O)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32N3O2P/c1-28-22-27(32)30-20-19-29-26(31)18-11-21-33(23-12-5-2-6-13-23,24-14-7-3-8-15-24)25-16-9-4-10-17-25/h2-10,12-17,28H,11,18-22H2,1H3,(H-,29,30,31,32)/p+1 |
| InChIKey | DBAWJPUQMOSDSK-UHFFFAOYSA-O |
| XLogP | 2.21 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|