C25H35N2O3P — CID 155930992
tert-butyl N-[(2S)-1-[[(2S)-1-diphenylphosphanylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 155930992) has the molecular formula C25H35N2O3P and a molecular weight of 442.54 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S)-1-diphenylphosphanylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S)-1-diphenylphosphanylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 155930992 |
| Molecular Formula | C25H35N2O3P |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S)-1-diphenylphosphanylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](C)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35N2O3P/c1-18(2)22(27-24(29)30-25(4,5)6)23(28)26-19(3)17-31(20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,18-19,22H,17H2,1-6H3,(H,26,28)(H,27,29)/t19-,22-/m0/s1 |
| InChIKey | KVKPZCKLHVKJJB-UGKGYDQZSA-N |
| XLogP | 4.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|