C8H15Br3O4 — CID 71341461
acetic acid;2,2,2-tribromo-1-[(2-methylpropan-2-yl)oxy]ethanol (PubChem CID 71341461) has the molecular formula C8H15Br3O4 and a molecular weight of 414.92 g/mol. Its IUPAC name is acetic acid;2,2,2-tribromo-1-[(2-methylpropan-2-yl)oxy]ethanol.
| Compound Name | acetic acid;2,2,2-tribromo-1-[(2-methylpropan-2-yl)oxy]ethanol |
|---|---|
| PubChem CID | 71341461 |
| Molecular Formula | C8H15Br3O4 |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 411.85 |
| IUPAC Name | acetic acid;2,2,2-tribromo-1-[(2-methylpropan-2-yl)oxy]ethanol |
| SMILES | CC(=O)O.CC(C)(C)OC(O)C(Br)(Br)Br |
| InChI | InChI=1S/C6H11Br3O2.C2H4O2/c1-5(2,3)11-4(10)6(7,8)9;1-2(3)4/h4,10H,1-3H3;1H3,(H,3,4) |
| InChIKey | LUDWUOXUYXBAMA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|