C8H13NOS2 — CID 71344470
1,3-dithiolan-2-yl(pyrrolidin-1-yl)methanone (PubChem CID 71344470) has the molecular formula C8H13NOS2 and a molecular weight of 203.33 g/mol. Its IUPAC name is 1,3-dithiolan-2-yl(pyrrolidin-1-yl)methanone.
| Compound Name | 1,3-dithiolan-2-yl(pyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 71344470 |
| Molecular Formula | C8H13NOS2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 1,3-dithiolan-2-yl(pyrrolidin-1-yl)methanone |
| SMILES | O=C(C1SCCS1)N1CCCC1 |
| InChI | InChI=1S/C8H13NOS2/c10-7(8-11-5-6-12-8)9-3-1-2-4-9/h8H,1-6H2 |
| InChIKey | LYIDCUJFCZTURW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |