C9H15N3S2 — CID 71346775
1,1-diethyl-3-(4-methyl-1,3-thiazol-2-yl)thiourea (PubChem CID 71346775) has the molecular formula C9H15N3S2 and a molecular weight of 229.37 g/mol. Its IUPAC name is 1,1-diethyl-3-(4-methyl-1,3-thiazol-2-yl)thiourea.
| Compound Name | 1,1-diethyl-3-(4-methyl-1,3-thiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 71346775 |
| Molecular Formula | C9H15N3S2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1,1-diethyl-3-(4-methyl-1,3-thiazol-2-yl)thiourea |
| SMILES | CCN(CC)C(=S)Nc1nc(C)cs1 |
| InChI | InChI=1S/C9H15N3S2/c1-4-12(5-2)9(13)11-8-10-7(3)6-14-8/h6H,4-5H2,1-3H3,(H,10,11,13) |
| InChIKey | MGTWKELPVOVVKW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|