C21H28Cl3NO — CID 71349193
1-(2,3-dichloro-5-heptoxypent-2-enyl)quinolin-1-ium chloride (PubChem CID 71349193) has the molecular formula C21H28Cl3NO and a molecular weight of 416.82 g/mol. Its IUPAC name is 1-(2,3-dichloro-5-heptoxypent-2-enyl)quinolin-1-ium chloride.
| Compound Name | 1-(2,3-dichloro-5-heptoxypent-2-enyl)quinolin-1-ium chloride |
|---|---|
| PubChem CID | 71349193 |
| Molecular Formula | C21H28Cl3NO |
| Molecular Weight | 416.82 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 1-(2,3-dichloro-5-heptoxypent-2-enyl)quinolin-1-ium chloride |
| SMILES | CCCCCCCOCCC(Cl)=C(Cl)C[n+]1cccc2ccccc21.[Cl-] |
| InChI | InChI=1S/C21H28Cl2NO.ClH/c1-2-3-4-5-8-15-25-16-13-19(22)20(23)17-24-14-9-11-18-10-6-7-12-21(18)24;/h6-7,9-12,14H,2-5,8,13,15-17H2,1H3;1H/q+1;/p-1 |
| InChIKey | AHAGEUGJRMPTRN-UHFFFAOYSA-M |
| XLogP | 3.20 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.82 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|