C9H18OS — CID 71351375
(2R,5R)-5-tert-butyl-2-methyl-1,3-oxathiane (PubChem CID 71351375) has the molecular formula C9H18OS and a molecular weight of 174.31 g/mol. Its IUPAC name is (2R,5R)-5-tert-butyl-2-methyl-1,3-oxathiane.
| Compound Name | (2R,5R)-5-tert-butyl-2-methyl-1,3-oxathiane |
|---|---|
| PubChem CID | 71351375 |
| Molecular Formula | C9H18OS |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | (2R,5R)-5-tert-butyl-2-methyl-1,3-oxathiane |
| SMILES | C[C@@H]1OC[C@@H](C(C)(C)C)CS1 |
| InChI | InChI=1S/C9H18OS/c1-7-10-5-8(6-11-7)9(2,3)4/h7-8H,5-6H2,1-4H3/t7-,8-/m1/s1 |
| InChIKey | XTLNXEVVZVWOQG-HTQZYQBOSA-N |
| XLogP | 2.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |