C10H20OS — CID 557698
2,5-di(propan-2-yl)-1,3-oxathiane (PubChem CID 557698) has the molecular formula C10H20OS and a molecular weight of 188.34 g/mol. Its IUPAC name is 2,5-di(propan-2-yl)-1,3-oxathiane.
| Compound Name | 2,5-di(propan-2-yl)-1,3-oxathiane |
|---|---|
| PubChem CID | 557698 |
| Molecular Formula | C10H20OS |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2,5-di(propan-2-yl)-1,3-oxathiane |
| SMILES | CC(C)C1COC(C(C)C)SC1 |
| InChI | InChI=1S/C10H20OS/c1-7(2)9-5-11-10(8(3)4)12-6-9/h7-10H,5-6H2,1-4H3 |
| InChIKey | PUNCQJVOBVQLAA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |