C11H18O2 — CID 71356025
(1R,4aS,7R,7aR)-1-methoxy-4,7-dimethyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran (PubChem CID 71356025) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (1R,4aS,7R,7aR)-1-methoxy-4,7-dimethyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran.
| Compound Name | (1R,4aS,7R,7aR)-1-methoxy-4,7-dimethyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran |
|---|---|
| PubChem CID | 71356025 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (1R,4aS,7R,7aR)-1-methoxy-4,7-dimethyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran |
| SMILES | CO[C@@H]1OC=C(C)[C@H]2CC[C@@H](C)[C@@H]12 |
| InChI | InChI=1S/C11H18O2/c1-7-4-5-9-8(2)6-13-11(12-3)10(7)9/h6-7,9-11H,4-5H2,1-3H3/t7-,9-,10-,11-/m1/s1 |
| InChIKey | IGZUHQCEDUZXSS-QCNRFFRDSA-N |
| XLogP | 2.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |