C38H36N6 — CID 71357012
3,6-bis[bis[(4-methylphenyl)methyl]amino]pyrazine-2,5-dicarbonitrile (PubChem CID 71357012) has the molecular formula C38H36N6 and a molecular weight of 576.75 g/mol. Its IUPAC name is 3,6-bis[bis[(4-methylphenyl)methyl]amino]pyrazine-2,5-dicarbonitrile.
| Compound Name | 3,6-bis[bis[(4-methylphenyl)methyl]amino]pyrazine-2,5-dicarbonitrile |
|---|---|
| PubChem CID | 71357012 |
| Molecular Formula | C38H36N6 |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | 3,6-bis[bis[(4-methylphenyl)methyl]amino]pyrazine-2,5-dicarbonitrile |
| SMILES | Cc1ccc(CN(Cc2ccc(C)cc2)c2nc(C#N)c(N(Cc3ccc(C)cc3)Cc3ccc(C)cc3)nc2C#N)cc1 |
| InChI | InChI=1S/C38H36N6/c1-27-5-13-31(14-6-27)23-43(24-32-15-7-28(2)8-16-32)37-35(21-39)42-38(36(22-40)41-37)44(25-33-17-9-29(3)10-18-33)26-34-19-11-30(4)12-20-34/h5-20H,23-26H2,1-4H3 |
| InChIKey | YZDDVYWVUZDSMP-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 79.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |