C12H14O — CID 71358238
1-(cyclopenten-1-yl)cyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 71358238) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 1-(cyclopenten-1-yl)cyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 1-(cyclopenten-1-yl)cyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 71358238 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 1-(cyclopenten-1-yl)cyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1(C2=CCCC2)C=CC=CC1 |
| InChI | InChI=1S/C12H14O/c13-10-12(8-4-1-5-9-12)11-6-2-3-7-11/h1,4-6,8,10H,2-3,7,9H2 |
| InChIKey | KESIZRXXVRWHEH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|