C24H19NO2 — CID 71359477
(1,5-diphenylpyrrol-2-yl)-(2-hydroxy-5-methylphenyl)methanone (PubChem CID 71359477) has the molecular formula C24H19NO2 and a molecular weight of 353.42 g/mol. Its IUPAC name is (1,5-diphenylpyrrol-2-yl)-(2-hydroxy-5-methylphenyl)methanone.
| Compound Name | (1,5-diphenylpyrrol-2-yl)-(2-hydroxy-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 71359477 |
| Molecular Formula | C24H19NO2 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (1,5-diphenylpyrrol-2-yl)-(2-hydroxy-5-methylphenyl)methanone |
| SMILES | Cc1ccc(O)c(C(=O)c2ccc(-c3ccccc3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C24H19NO2/c1-17-12-15-23(26)20(16-17)24(27)22-14-13-21(18-8-4-2-5-9-18)25(22)19-10-6-3-7-11-19/h2-16,26H,1H3 |
| InChIKey | MTHYBKFPWLOIRQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |