C11H20O — CID 71361046
9-methyldeca-4,8-dien-1-ol (PubChem CID 71361046) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 9-methyldeca-4,8-dien-1-ol.
| Compound Name | 9-methyldeca-4,8-dien-1-ol |
|---|---|
| PubChem CID | 71361046 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 9-methyldeca-4,8-dien-1-ol |
| SMILES | CC(C)=CCCC=CCCCO |
| InChI | InChI=1S/C11H20O/c1-11(2)9-7-5-3-4-6-8-10-12/h3-4,9,12H,5-8,10H2,1-2H3 |
| InChIKey | MULMISXPVNLVDM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|