C14H8O — CID 71361424
3-oxatetracyclo[9.4.0.02,4.06,10]pentadeca-1(15),2(4),5,7,9,11,13-heptaene (PubChem CID 71361424) has the molecular formula C14H8O and a molecular weight of 192.22 g/mol. Its IUPAC name is 3-oxatetracyclo[9.4.0.02,4.06,10]pentadeca-1(15),2(4),5,7,9,11,13-heptaene.
| Compound Name | 3-oxatetracyclo[9.4.0.02,4.06,10]pentadeca-1(15),2(4),5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 71361424 |
| Molecular Formula | C14H8O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 3-oxatetracyclo[9.4.0.02,4.06,10]pentadeca-1(15),2(4),5,7,9,11,13-heptaene |
| SMILES | c1cc2cc3c(c4ccccc4c-2c1)O3 |
| InChI | InChI=1S/C14H8O/c1-2-6-12-11(5-1)10-7-3-4-9(10)8-13-14(12)15-13/h1-8H |
| InChIKey | RHHADPNGZCSMBC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|