C18H16ClN3 — CID 71361497
4-[(4-chlorophenyl)diazenyl]-N,N-dimethylnaphthalen-1-amine (PubChem CID 71361497) has the molecular formula C18H16ClN3 and a molecular weight of 309.80 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)diazenyl]-N,N-dimethylnaphthalen-1-amine.
| Compound Name | 4-[(4-chlorophenyl)diazenyl]-N,N-dimethylnaphthalen-1-amine |
|---|---|
| PubChem CID | 71361497 |
| Molecular Formula | C18H16ClN3 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-[(4-chlorophenyl)diazenyl]-N,N-dimethylnaphthalen-1-amine |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C18H16ClN3/c1-22(2)18-12-11-17(15-5-3-4-6-16(15)18)21-20-14-9-7-13(19)8-10-14/h3-12H,1-2H3/b21-20+ |
| InChIKey | XXPRXOUXPKQSIZ-QZQOTICOSA-N |
| XLogP | 5.97 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|