C9H15ClN2O4 — CID 71369331
4-tert-butylpyridin-1-ium-1-amine perchlorate (PubChem CID 71369331) has the molecular formula C9H15ClN2O4 and a molecular weight of 250.68 g/mol. Its IUPAC name is 4-tert-butylpyridin-1-ium-1-amine perchlorate.
| Compound Name | 4-tert-butylpyridin-1-ium-1-amine perchlorate |
|---|---|
| PubChem CID | 71369331 |
| Molecular Formula | C9H15ClN2O4 |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 4-tert-butylpyridin-1-ium-1-amine perchlorate |
| SMILES | CC(C)(C)c1cc[n+](N)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C9H15N2.ClHO4/c1-9(2,3)8-4-6-11(10)7-5-8;2-1(3,4)5/h4-7H,10H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | PCHKEIRDMKNIIB-UHFFFAOYSA-M |
| XLogP | -3.77 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|