C16H20ClNO5 — CID 44887729
4-tert-butyl-1-phenylmethoxypyridin-1-ium perchlorate (PubChem CID 44887729) has the molecular formula C16H20ClNO5 and a molecular weight of 341.79 g/mol. Its IUPAC name is 4-tert-butyl-1-phenylmethoxypyridin-1-ium perchlorate.
| Compound Name | 4-tert-butyl-1-phenylmethoxypyridin-1-ium perchlorate |
|---|---|
| PubChem CID | 44887729 |
| Molecular Formula | C16H20ClNO5 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 4-tert-butyl-1-phenylmethoxypyridin-1-ium perchlorate |
| SMILES | CC(C)(C)c1cc[n+](OCc2ccccc2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C16H20NO.ClHO4/c1-16(2,3)15-9-11-17(12-10-15)18-13-14-7-5-4-6-8-14;2-1(3,4)5/h4-12H,13H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | ZTGLUQRPXHISAM-UHFFFAOYSA-M |
| XLogP | -1.86 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|