methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate

C16H14Cl2O4 — CID 71371053

IUPACmethyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate
SMILESCOC(=O)c1ccccc1COCOc1cc(Cl)cc(Cl)c1
InChIInChI=1S/C16H14Cl2O4/c1-20-16(19)15-5-3-2-4-11(15)9-21-10-22-14-7-12(17)6-13(18)8-14/h2-8H,9-10H2,1H3
InChIKeyKISQWBCUCWKJKG-UHFFFAOYSA-N
MW341.19 g/mol
LogP4.33
Rot. Bonds6

About methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate

methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate (PubChem CID 71371053) has the molecular formula C16H14Cl2O4 and a molecular weight of 341.19 g/mol. Its IUPAC name is methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate.

Molecular Properties

Compound Namemethyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate
PubChem CID71371053
Molecular FormulaC16H14Cl2O4
Molecular Weight341.19 g/mol
Exact Mass340.03
IUPAC Namemethyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate
SMILESCOC(=O)c1ccccc1COCOc1cc(Cl)cc(Cl)c1
InChIInChI=1S/C16H14Cl2O4/c1-20-16(19)15-5-3-2-4-11(15)9-21-10-22-14-7-12(17)6-13(18)8-14/h2-8H,9-10H2,1H3
InChIKeyKISQWBCUCWKJKG-UHFFFAOYSA-N
XLogP4.33
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500341.19
LogP ≤ 54.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate?
The IUPAC name of methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate (CID 71371053) is methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate.
What is the SMILES notation for methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate?
The canonical SMILES for methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate is COC(=O)c1ccccc1COCOc1cc(Cl)cc(Cl)c1.
What is the InChIKey of methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate?
The InChIKey is KISQWBCUCWKJKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2O4/c1-20-16(19)15-5-3-2-4-11(15)9-21-10-22-14-7-12(17)6-13(18)8-14/h2-8H,9-10H2,1H3.
What are the key properties of methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate?
methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate has a molecular weight of 341.19 g/mol, XLogP of 4.33, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate is sourced from PubChem (CID 71371053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).