C16H14Cl2O4 — CID 71371053
methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate (PubChem CID 71371053) has the molecular formula C16H14Cl2O4 and a molecular weight of 341.19 g/mol. Its IUPAC name is methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate.
| Compound Name | methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate |
|---|---|
| PubChem CID | 71371053 |
| Molecular Formula | C16H14Cl2O4 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | methyl 2-[(3,5-dichlorophenoxy)methoxymethyl]benzoate |
| SMILES | COC(=O)c1ccccc1COCOc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2O4/c1-20-16(19)15-5-3-2-4-11(15)9-21-10-22-14-7-12(17)6-13(18)8-14/h2-8H,9-10H2,1H3 |
| InChIKey | KISQWBCUCWKJKG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|