About methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate
methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate (PubChem CID 101177991) has the molecular formula C17H16Cl2O4
and a molecular weight of 355.22 g/mol. Its IUPAC name is methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate.
Molecular Properties
| Compound Name | methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate |
| PubChem CID | 101177991 |
| Molecular Formula | C17H16Cl2O4 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate |
| SMILES | COC(=O)C(OC)c1ccccc1COc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2O4/c1-21-16(17(20)22-2)15-6-4-3-5-11(15)10-23-14-8-12(18)7-13(19)9-14/h3-9,16H,10H2,1-2H3 |
| InChIKey | SRMXOIBOUYOXNC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate?
The IUPAC name of methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate (CID 101177991) is methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate.
What is the SMILES notation for methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate?
The canonical SMILES for methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate is COC(=O)C(OC)c1ccccc1COc1cc(Cl)cc(Cl)c1.
What is the InChIKey of methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate?
The InChIKey is SRMXOIBOUYOXNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl2O4/c1-21-16(17(20)22-2)15-6-4-3-5-11(15)10-23-14-8-12(18)7-13(19)9-14/h3-9,16H,10H2,1-2H3.
What are the key properties of methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate?
methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate has a molecular weight of 355.22 g/mol, XLogP of 4.43, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-[(3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyacetate is sourced from PubChem (CID 101177991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).