C20H28N4O3 — CID 174772151
2-methoxy-N-methyl-2-[2-[[2,4,5-tris(methylamino)phenoxy]methyl]phenyl]acetamide (PubChem CID 174772151) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-methoxy-N-methyl-2-[2-[[2,4,5-tris(methylamino)phenoxy]methyl]phenyl]acetamide.
| Compound Name | 2-methoxy-N-methyl-2-[2-[[2,4,5-tris(methylamino)phenoxy]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 174772151 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 2-methoxy-N-methyl-2-[2-[[2,4,5-tris(methylamino)phenoxy]methyl]phenyl]acetamide |
| SMILES | CNC(=O)C(OC)c1ccccc1COc1cc(NC)c(NC)cc1NC |
| InChI | InChI=1S/C20H28N4O3/c1-21-15-10-17(23-3)18(11-16(15)22-2)27-12-13-8-6-7-9-14(13)19(26-5)20(25)24-4/h6-11,19,21-23H,12H2,1-5H3,(H,24,25) |
| InChIKey | WXGIUHTZRWJOEW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|