C23H32N2O5 — CID 54235640
ethane;methyl 2-methoxy-2-[2-[[6-[(Z)-N-methoxy-C-methylcarbonimidoyl]-3,5-dimethyl-2-pyridinyl]oxymethyl]phenyl]acetate (PubChem CID 54235640) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is ethane;methyl 2-methoxy-2-[2-[[6-[(Z)-N-methoxy-C-methylcarbonimidoyl]-3,5-dimethyl-2-pyridinyl]oxymethyl]phenyl]acetate.
| Compound Name | ethane;methyl 2-methoxy-2-[2-[[6-[(Z)-N-methoxy-C-methylcarbonimidoyl]-3,5-dimethyl-2-pyridinyl]oxymethyl]phenyl]acetate |
|---|---|
| PubChem CID | 54235640 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | ethane;methyl 2-methoxy-2-[2-[[6-[(Z)-N-methoxy-C-methylcarbonimidoyl]-3,5-dimethyl-2-pyridinyl]oxymethyl]phenyl]acetate |
| SMILES | CC.CO/N=C(/C)c1nc(OCc2ccccc2C(OC)C(=O)OC)c(C)cc1C |
| InChI | InChI=1S/C21H26N2O5.C2H6/c1-13-11-14(2)20(22-18(13)15(3)23-27-6)28-12-16-9-7-8-10-17(16)19(25-4)21(24)26-5;1-2/h7-11,19H,12H2,1-6H3;1-2H3/b23-15-; |
| InChIKey | QMJKVYPBFYLNFP-HNALGXGESA-N |
| XLogP | 4.53 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|